C26H29F2N7O — CID 145330101
[(2R,3R,4R)-3-amino-2,4-dimethylpyrrolidin-1-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-6-yl]methanone (PubChem CID 145330101) has the molecular formula C26H29F2N7O and a molecular weight of 493.56 g/mol. Its IUPAC name is [(2R,3R,4R)-3-amino-2,4-dimethylpyrrolidin-1-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-6-yl]methanone.
| Compound Name | [(2R,3R,4R)-3-amino-2,4-dimethylpyrrolidin-1-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-6-yl]methanone |
|---|---|
| PubChem CID | 145330101 |
| Molecular Formula | C26H29F2N7O |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | [(2R,3R,4R)-3-amino-2,4-dimethylpyrrolidin-1-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-3-(2,2-difluoroethyl)imidazo[4,5-b]pyridin-6-yl]methanone |
| SMILES | C[C@@H]1CN(C(=O)c2cnc3c(c2)nc(-c2cc4cccnc4n2CC2CC2)n3CC(F)F)[C@H](C)[C@@H]1N |
| InChI | InChI=1S/C26H29F2N7O/c1-14-11-33(15(2)22(14)29)26(36)18-8-19-24(31-10-18)35(13-21(27)28)25(32-19)20-9-17-4-3-7-30-23(17)34(20)12-16-5-6-16/h3-4,7-10,14-16,21-22H,5-6,11-13,29H2,1-2H3/t14-,15-,22-/m1/s1 |
| InChIKey | PWJZGSIXOGGMSH-DOQJBMMISA-N |
| XLogP | 3.93 |
| TPSA | 94.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |