C20H18N4O4S — CID 145330332
7-[2-methyl-4-[(3R)-oxolan-3-yl]oxyphenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 145330332) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 7-[2-methyl-4-[(3R)-oxolan-3-yl]oxyphenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-[2-methyl-4-[(3R)-oxolan-3-yl]oxyphenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 145330332 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 7-[2-methyl-4-[(3R)-oxolan-3-yl]oxyphenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | Cc1cc(O[C@@H]2CCOC2)ccc1N1C(=O)Nc2c(C(N)=O)sc3nccc1c23 |
| InChI | InChI=1S/C20H18N4O4S/c1-10-8-11(28-12-5-7-27-9-12)2-3-13(10)24-14-4-6-22-19-15(14)16(23-20(24)26)17(29-19)18(21)25/h2-4,6,8,12H,5,7,9H2,1H3,(H2,21,25)(H,23,26)/t12-/m1/s1 |
| InChIKey | PAWBPYZWQSXTEO-GFCCVEGCSA-N |
| XLogP | 3.55 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |