C23H31FN6S — CID 145330521
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(6-amino-3-pyridinyl)-2-fluorobenzenecarboximidothioate (PubChem CID 145330521) has the molecular formula C23H31FN6S and a molecular weight of 442.61 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(6-amino-3-pyridinyl)-2-fluorobenzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(6-amino-3-pyridinyl)-2-fluorobenzenecarboximidothioate |
|---|---|
| PubChem CID | 145330521 |
| Molecular Formula | C23H31FN6S |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 4-(6-amino-3-pyridinyl)-2-fluorobenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(-c2ccc(N)nc2)cc1F)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H31FN6S/c1-22(2)11-16(12-23(3,4)29-22)30(5)21(27)31-20(26)17-8-6-14(10-18(17)24)15-7-9-19(25)28-13-15/h6-10,13,16,26-27,29H,11-12H2,1-5H3,(H2,25,28)/b26-20+,27-21- |
| InChIKey | OIXPZBAKDKEMGH-DSKJESRBSA-N |
| XLogP | 4.70 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|