C20H29FN4O2S — CID 145330551
methyl 3-fluoro-4-[C-[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylcarbonimidoyl]benzoate (PubChem CID 145330551) has the molecular formula C20H29FN4O2S and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl 3-fluoro-4-[C-[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylcarbonimidoyl]benzoate.
| Compound Name | methyl 3-fluoro-4-[C-[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylcarbonimidoyl]benzoate |
|---|---|
| PubChem CID | 145330551 |
| Molecular Formula | C20H29FN4O2S |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl 3-fluoro-4-[C-[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl]sulfanylcarbonimidoyl]benzoate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1ccc(C(=O)OC)cc1F)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H29FN4O2S/c1-19(2)10-13(11-20(3,4)24-19)25(5)18(23)28-16(22)14-8-7-12(9-15(14)21)17(26)27-6/h7-9,13,22-24H,10-11H2,1-6H3/b22-16+,23-18- |
| InChIKey | MFOPAIYYHIXXPE-UDMCLHRDSA-N |
| XLogP | 3.85 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|