C21H30N6OS — CID 145330553
[N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-hydroxy-5-pyrazol-1-ylbenzenecarboximidothioate (PubChem CID 145330553) has the molecular formula C21H30N6OS and a molecular weight of 414.58 g/mol. Its IUPAC name is [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-hydroxy-5-pyrazol-1-ylbenzenecarboximidothioate.
| Compound Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-hydroxy-5-pyrazol-1-ylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 145330553 |
| Molecular Formula | C21H30N6OS |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | [N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)carbamimidoyl] 2-hydroxy-5-pyrazol-1-ylbenzenecarboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])c1cc(-n2cccn2)ccc1O)N(C)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H30N6OS/c1-20(2)12-15(13-21(3,4)25-20)26(5)19(23)29-18(22)16-11-14(7-8-17(16)28)27-10-6-9-24-27/h6-11,15,22-23,25,28H,12-13H2,1-5H3/b22-18+,23-19- |
| InChIKey | DIXFXHAANANTAS-YLRGQORSSA-N |
| XLogP | 3.81 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|