C16H33NO3 — CID 145330639
tert-butyl 3-prop-2-enoxypyrrolidine-1-carboxylate;ethane (PubChem CID 145330639) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is tert-butyl 3-prop-2-enoxypyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-prop-2-enoxypyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 145330639 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | tert-butyl 3-prop-2-enoxypyrrolidine-1-carboxylate;ethane |
| SMILES | C=CCOC1CCN(C(=O)OC(C)(C)C)C1.CC.CC |
| InChI | InChI=1S/C12H21NO3.2C2H6/c1-5-8-15-10-6-7-13(9-10)11(14)16-12(2,3)4;2*1-2/h5,10H,1,6-9H2,2-4H3;2*1-2H3 |
| InChIKey | OTXCOCFZKGNKPE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|