C8H16NO5P — CID 145330653
[3-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-oxopropyl]phosphonic acid (PubChem CID 145330653) has the molecular formula C8H16NO5P and a molecular weight of 237.19 g/mol. Its IUPAC name is [3-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-oxopropyl]phosphonic acid.
| Compound Name | [3-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-oxopropyl]phosphonic acid |
|---|---|
| PubChem CID | 145330653 |
| Molecular Formula | C8H16NO5P |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | [3-[2-(hydroxymethyl)pyrrolidin-1-yl]-3-oxopropyl]phosphonic acid |
| SMILES | O=C(CCP(=O)(O)O)N1CCCC1CO |
| InChI | InChI=1S/C8H16NO5P/c10-6-7-2-1-4-9(7)8(11)3-5-15(12,13)14/h7,10H,1-6H2,(H2,12,13,14) |
| InChIKey | GHPAQMIRYAUDGR-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|