C22H29ClN3O8P — CID 145330845
propan-2-yl (2S)-2-[[[(2S,4R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 145330845) has the molecular formula C22H29ClN3O8P and a molecular weight of 529.91 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,4R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,4R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145330845 |
| Molecular Formula | C22H29ClN3O8P |
| Molecular Weight | 529.91 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,4R)-4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OC[C@@H]1C[C@@](C)(Cl)C(n2ccc(=O)[nH]c2=O)O1)Oc1ccccc1 |
| InChI | InChI=1S/C22H29ClN3O8P/c1-14(2)32-19(28)15(3)25-35(30,34-16-8-6-5-7-9-16)31-13-17-12-22(4,23)20(33-17)26-11-10-18(27)24-21(26)29/h5-11,14-15,17,20H,12-13H2,1-4H3,(H,25,30)(H,24,27,29)/t15-,17-,20?,22+,35-/m0/s1 |
| InChIKey | WWFQGIMOPBRXMJ-CDWLIZJUSA-N |
| XLogP | 2.95 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.91 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|