C12H20N2O2 — CID 145330912
ethane;(3,5,6-trimethylpyrazin-2-yl)methyl acetate (PubChem CID 145330912) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is ethane;(3,5,6-trimethylpyrazin-2-yl)methyl acetate.
| Compound Name | ethane;(3,5,6-trimethylpyrazin-2-yl)methyl acetate |
|---|---|
| PubChem CID | 145330912 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | ethane;(3,5,6-trimethylpyrazin-2-yl)methyl acetate |
| SMILES | CC.CC(=O)OCc1nc(C)c(C)nc1C |
| InChI | InChI=1S/C10H14N2O2.C2H6/c1-6-7(2)12-10(8(3)11-6)5-14-9(4)13;1-2/h5H2,1-4H3;1-2H3 |
| InChIKey | WHOBWLAJJQYYFI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |