About N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen
N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen (PubChem CID 145331086) has the molecular formula C7H22N6
and a molecular weight of 190.30 g/mol. Its IUPAC name is N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen.
Molecular Properties
| Compound Name | N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen |
| PubChem CID | 145331086 |
| Molecular Formula | C7H22N6 |
| Molecular Weight | 190.30 g/mol |
| Exact Mass | 190.19 |
| IUPAC Name | N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen |
| SMILES | CN1CCN/C(=C(N)\N=C/N)C1.N.[H][H].[H][H] |
| InChI | InChI=1S/C7H15N5.H3N.2H2/c1-12-3-2-10-6(4-12)7(9)11-5-8;;;/h5,10H,2-4,9H2,1H3,(H2,8,11);1H3;2*1H/b7-6-;;; |
| InChIKey | JJPVWSIVJOTILT-YYFHNNNUSA-N |
| XLogP | -0.71 |
| TPSA | 114.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.30 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen?
The IUPAC name of N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen (CID 145331086) is N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen.
What is the SMILES notation for N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen?
The canonical SMILES for N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen is CN1CCN/C(=C(N)\N=C/N)C1.N.[H][H].[H][H].
What is the InChIKey of N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen?
The InChIKey is JJPVWSIVJOTILT-YYFHNNNUSA-N. The full InChI is InChI=1S/C7H15N5.H3N.2H2/c1-12-3-2-10-6(4-12)7(9)11-5-8;;;/h5,10H,2-4,9H2,1H3,(H2,8,11);1H3;2*1H/b7-6-;;;.
What are the key properties of N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen?
N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen has a molecular weight of 190.30 g/mol, XLogP of -0.71, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-amino-(4-methylpiperazin-2-ylidene)methyl]methanimidamide;azane;molecular hydrogen is sourced from PubChem (CID 145331086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).