About (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen
(2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen (PubChem CID 145331124) has the molecular formula C8H17N5
and a molecular weight of 183.26 g/mol. Its IUPAC name is (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen |
| PubChem CID | 145331124 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen |
| SMILES | CN1CCN(N)/C(=C2/CN=CN2)C1.[H][H] |
| InChI | InChI=1S/C8H15N5.H2/c1-12-2-3-13(9)8(5-12)7-4-10-6-11-7;/h6H,2-5,9H2,1H3,(H,10,11);1H/b8-7-; |
| InChIKey | JCIYCWBOCBYRCK-CFYXSCKTSA-N |
| XLogP | -0.80 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen?
The IUPAC name of (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen (CID 145331124) is (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen.
What is the SMILES notation for (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen?
The canonical SMILES for (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen is CN1CCN(N)/C(=C2/CN=CN2)C1.[H][H].
What is the InChIKey of (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen?
The InChIKey is JCIYCWBOCBYRCK-CFYXSCKTSA-N. The full InChI is InChI=1S/C8H15N5.H2/c1-12-2-3-13(9)8(5-12)7-4-10-6-11-7;/h6H,2-5,9H2,1H3,(H,10,11);1H/b8-7-;.
What are the key properties of (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen?
(2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen has a molecular weight of 183.26 g/mol, XLogP of -0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(1,4-dihydroimidazol-5-ylidene)-4-methylpiperazin-1-amine;molecular hydrogen is sourced from PubChem (CID 145331124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).