C8H8O3 — CID 145331546
3,6-dimethyl-2H-furo[3,2-b]furan-5-one (PubChem CID 145331546) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is 3,6-dimethyl-2H-furo[3,2-b]furan-5-one.
| Compound Name | 3,6-dimethyl-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 145331546 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 3,6-dimethyl-2H-furo[3,2-b]furan-5-one |
| SMILES | CC1=C2OC(=O)C(C)=C2OC1 |
| InChI | InChI=1S/C8H8O3/c1-4-3-10-7-5(2)8(9)11-6(4)7/h3H2,1-2H3 |
| InChIKey | YNAIZJDSIZUIIO-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |