About (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene
(10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene (PubChem CID 145331638) has the molecular formula C18H16
and a molecular weight of 232.33 g/mol. Its IUPAC name is (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene.
Molecular Properties
| Compound Name | (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene |
| PubChem CID | 145331638 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene |
| SMILES | C1=C/C2=C/CC=C(c3ccccc3)C=CC2C=C1 |
| InChI | InChI=1S/C18H16/c1-2-7-15(8-3-1)18-12-6-11-16-9-4-5-10-17(16)13-14-18/h1-5,7-14,17H,6H2/b14-13?,16-11-,18-12? |
| InChIKey | HJAHIJJMNVJSGW-LZUYEMGZSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene?
The IUPAC name of (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene (CID 145331638) is (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene.
What is the SMILES notation for (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene?
The canonical SMILES for (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene is C1=C/C2=C/CC=C(c3ccccc3)C=CC2C=C1.
What is the InChIKey of (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene?
The InChIKey is HJAHIJJMNVJSGW-LZUYEMGZSA-N. The full InChI is InChI=1S/C18H16/c1-2-7-15(8-3-1)18-12-6-11-16-9-4-5-10-17(16)13-14-18/h1-5,7-14,17H,6H2/b14-13?,16-11-,18-12?.
What are the key properties of (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene?
(10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene has a molecular weight of 232.33 g/mol, XLogP of 4.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene is sourced from PubChem (CID 145331638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).