C18H16 — CID 145331638
(10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene (PubChem CID 145331638) has the molecular formula C18H16 and a molecular weight of 232.33 g/mol. Its IUPAC name is (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene.
| Compound Name | (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene |
|---|---|
| PubChem CID | 145331638 |
| Molecular Formula | C18H16 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (10Z)-7-phenyl-4a,9-dihydrobenzo[8]annulene |
| SMILES | C1=C/C2=C/CC=C(c3ccccc3)C=CC2C=C1 |
| InChI | InChI=1S/C18H16/c1-2-7-15(8-3-1)18-12-6-11-16-9-4-5-10-17(16)13-14-18/h1-5,7-14,17H,6H2/b14-13?,16-11-,18-12? |
| InChIKey | HJAHIJJMNVJSGW-LZUYEMGZSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |