C15H12N2O4 — CID 145332594
2-nitro-5-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxypyridine (PubChem CID 145332594) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 2-nitro-5-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxypyridine.
| Compound Name | 2-nitro-5-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxypyridine |
|---|---|
| PubChem CID | 145332594 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-nitro-5-spiro[2H-1-benzofuran-3,1'-cyclopropane]-4-yloxypyridine |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc3c2C2(CC2)CO3)cn1 |
| InChI | InChI=1S/C15H12N2O4/c18-17(19)13-5-4-10(8-16-13)21-12-3-1-2-11-14(12)15(6-7-15)9-20-11/h1-5,8H,6-7,9H2 |
| InChIKey | VLKCENBWAJFUPE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|