C27H33N5O4 — CID 145332734
3-[4-[[(2-methoxybenzoyl)amino]methyl]phenyl]-5-(methylamino)-1-(oxolan-3-yl)pyrazole-4-carboxamide;prop-1-ene (PubChem CID 145332734) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is 3-[4-[[(2-methoxybenzoyl)amino]methyl]phenyl]-5-(methylamino)-1-(oxolan-3-yl)pyrazole-4-carboxamide;prop-1-ene.
| Compound Name | 3-[4-[[(2-methoxybenzoyl)amino]methyl]phenyl]-5-(methylamino)-1-(oxolan-3-yl)pyrazole-4-carboxamide;prop-1-ene |
|---|---|
| PubChem CID | 145332734 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 3-[4-[[(2-methoxybenzoyl)amino]methyl]phenyl]-5-(methylamino)-1-(oxolan-3-yl)pyrazole-4-carboxamide;prop-1-ene |
| SMILES | C=CC.CNc1c(C(N)=O)c(-c2ccc(CNC(=O)c3ccccc3OC)cc2)nn1C1CCOC1 |
| InChI | InChI=1S/C24H27N5O4.C3H6/c1-26-23-20(22(25)30)21(28-29(23)17-11-12-33-14-17)16-9-7-15(8-10-16)13-27-24(31)18-5-3-4-6-19(18)32-2;1-3-2/h3-10,17,26H,11-14H2,1-2H3,(H2,25,30)(H,27,31);3H,1H2,2H3 |
| InChIKey | NXDCTRBTQBCBHK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|