C13H24INO — CID 145332815
(2Z,5E)-4-[3-[iodo(methyl)amino]propyl]-3,5-dimethylhepta-2,5-dien-4-ol (PubChem CID 145332815) has the molecular formula C13H24INO and a molecular weight of 337.25 g/mol. Its IUPAC name is (2Z,5E)-4-[3-[iodo(methyl)amino]propyl]-3,5-dimethylhepta-2,5-dien-4-ol.
| Compound Name | (2Z,5E)-4-[3-[iodo(methyl)amino]propyl]-3,5-dimethylhepta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 145332815 |
| Molecular Formula | C13H24INO |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (2Z,5E)-4-[3-[iodo(methyl)amino]propyl]-3,5-dimethylhepta-2,5-dien-4-ol |
| SMILES | C/C=C(/C)C(O)(CCCN(C)I)/C(C)=C/C |
| InChI | InChI=1S/C13H24INO/c1-6-11(3)13(16,12(4)7-2)9-8-10-15(5)14/h6-7,16H,8-10H2,1-5H3/b11-6-,12-7+ |
| InChIKey | CVVIPQCKXVMXDY-TWTKIJFOSA-N |
| XLogP | 3.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|