C20H37NO3 — CID 145332819
tert-butyl N-[(Z)-4-[(E)-but-2-en-2-yl]-4-hydroxy-5-methylhept-5-enyl]-N-propylcarbamate (PubChem CID 145332819) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4-[(E)-but-2-en-2-yl]-4-hydroxy-5-methylhept-5-enyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[(Z)-4-[(E)-but-2-en-2-yl]-4-hydroxy-5-methylhept-5-enyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 145332819 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | tert-butyl N-[(Z)-4-[(E)-but-2-en-2-yl]-4-hydroxy-5-methylhept-5-enyl]-N-propylcarbamate |
| SMILES | C/C=C(/C)C(O)(CCCN(CCC)C(=O)OC(C)(C)C)/C(C)=C/C |
| InChI | InChI=1S/C20H37NO3/c1-9-14-21(18(22)24-19(6,7)8)15-12-13-20(23,16(4)10-2)17(5)11-3/h10-11,23H,9,12-15H2,1-8H3/b16-10-,17-11+ |
| InChIKey | VEFOLNUWQDPSID-VRNBXGKJSA-N |
| XLogP | 5.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|