C20H43NO — CID 145332820
(2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol;ethane (PubChem CID 145332820) has the molecular formula C20H43NO and a molecular weight of 313.57 g/mol. Its IUPAC name is (2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol;ethane.
| Compound Name | (2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol;ethane |
|---|---|
| PubChem CID | 145332820 |
| Molecular Formula | C20H43NO |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.33 |
| IUPAC Name | (2E,5E)-4-[3-(diethylamino)propyl]-3,5-dimethylhepta-2,5-dien-4-ol;ethane |
| SMILES | C/C=C(\C)C(O)(CCCN(CC)CC)/C(C)=C/C.CC.CC |
| InChI | InChI=1S/C16H31NO.2C2H6/c1-7-14(5)16(18,15(6)8-2)12-11-13-17(9-3)10-4;2*1-2/h7-8,18H,9-13H2,1-6H3;2*1-2H3/b14-7+,15-8+;; |
| InChIKey | QHLJYNKVEGZVTC-RYCJZZGNSA-N |
| XLogP | 5.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|