C28H36O7 — CID 145332895
(1R,2S,5R,6R,9S,11R,12R,13R)-12-hydroxy-2,5,6,6',6',13-hexamethyl-10-methylidene-13-prop-1-en-2-ylspiro[3,14-dioxatetracyclo[9.4.1.01,5.06,11]hexadecane-9,5'-pyran]-2',4,15-trione (PubChem CID 145332895) has the molecular formula C28H36O7 and a molecular weight of 484.59 g/mol. Its IUPAC name is (1R,2S,5R,6R,9S,11R,12R,13R)-12-hydroxy-2,5,6,6',6',13-hexamethyl-10-methylidene-13-prop-1-en-2-ylspiro[3,14-dioxatetracyclo[9.4.1.01,5.06,11]hexadecane-9,5'-pyran]-2',4,15-trione.
| Compound Name | (1R,2S,5R,6R,9S,11R,12R,13R)-12-hydroxy-2,5,6,6',6',13-hexamethyl-10-methylidene-13-prop-1-en-2-ylspiro[3,14-dioxatetracyclo[9.4.1.01,5.06,11]hexadecane-9,5'-pyran]-2',4,15-trione |
|---|---|
| PubChem CID | 145332895 |
| Molecular Formula | C28H36O7 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | (1R,2S,5R,6R,9S,11R,12R,13R)-12-hydroxy-2,5,6,6',6',13-hexamethyl-10-methylidene-13-prop-1-en-2-ylspiro[3,14-dioxatetracyclo[9.4.1.01,5.06,11]hexadecane-9,5'-pyran]-2',4,15-trione |
| SMILES | C=C(C)[C@@]1(C)OC(=O)[C@]23C[C@]4(C(=C)[C@@]5(C=CC(=O)OC5(C)C)CC[C@@]4(C)[C@@]2(C)C(=O)O[C@H]3C)[C@H]1O |
| InChI | InChI=1S/C28H36O7/c1-15(2)24(8)19(30)27-14-28(21(32)35-24)17(4)33-20(31)25(28,9)23(27,7)12-13-26(16(27)3)11-10-18(29)34-22(26,5)6/h10-11,17,19,30H,1,3,12-14H2,2,4-9H3/t17-,19-,23-,24+,25+,26+,27-,28+/m0/s1 |
| InChIKey | OEUMYMWDGGXEEY-RFKOTIHKSA-N |
| XLogP | 3.80 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|