C9H11F6NO — CID 145333571
2,2,2-trifluoro-N-methyl-N-[(E)-6,6,6-trifluorohex-3-enyl]acetamide (PubChem CID 145333571) has the molecular formula C9H11F6NO and a molecular weight of 263.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[(E)-6,6,6-trifluorohex-3-enyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[(E)-6,6,6-trifluorohex-3-enyl]acetamide |
|---|---|
| PubChem CID | 145333571 |
| Molecular Formula | C9H11F6NO |
| Molecular Weight | 263.18 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[(E)-6,6,6-trifluorohex-3-enyl]acetamide |
| SMILES | CN(CC/C=C/CC(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H11F6NO/c1-16(7(17)9(13,14)15)6-4-2-3-5-8(10,11)12/h2-3H,4-6H2,1H3/b3-2+ |
| InChIKey | CYAYYISNVXKACW-NSCUHMNNSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|