About [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid (PubChem CID 145333613) has the molecular formula C7H12O4S
and a molecular weight of 192.24 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid.
Molecular Properties
| Compound Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid |
| PubChem CID | 145333613 |
| Molecular Formula | C7H12O4S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid |
| SMILES | CC1(C)OC[C@@H](COC(=O)S)O1 |
| InChI | InChI=1S/C7H12O4S/c1-7(2)10-4-5(11-7)3-9-6(8)12/h5H,3-4H2,1-2H3,(H,8,12)/t5-/m1/s1 |
| InChIKey | SEZHWXQKZMWZJU-RXMQYKEDSA-N |
| XLogP | 1.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid?
The IUPAC name of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid (CID 145333613) is [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid.
What is the SMILES notation for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid?
The canonical SMILES for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid is CC1(C)OC[C@@H](COC(=O)S)O1.
What is the InChIKey of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid?
The InChIKey is SEZHWXQKZMWZJU-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H12O4S/c1-7(2)10-4-5(11-7)3-9-6(8)12/h5H,3-4H2,1-2H3,(H,8,12)/t5-/m1/s1.
What are the key properties of [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid?
[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid has a molecular weight of 192.24 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxymethanethioic S-acid is sourced from PubChem (CID 145333613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).