C29H29FN3O6S+ — CID 145333634
[(3R,5R)-14-(8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-10-yl)-9-hydroxy-5-methyl-12-oxo-1,2-diaza-8-azoniatricyclo[8.4.0.03,8]tetradeca-8,10,13-trien-11-yl]oxymethyl methyl carbonate (PubChem CID 145333634) has the molecular formula C29H29FN3O6S+ and a molecular weight of 566.63 g/mol. Its IUPAC name is [(3R,5R)-14-(8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-10-yl)-9-hydroxy-5-methyl-12-oxo-1,2-diaza-8-azoniatricyclo[8.4.0.03,8]tetradeca-8,10,13-trien-11-yl]oxymethyl methyl carbonate.
| Compound Name | [(3R,5R)-14-(8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-10-yl)-9-hydroxy-5-methyl-12-oxo-1,2-diaza-8-azoniatricyclo[8.4.0.03,8]tetradeca-8,10,13-trien-11-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 145333634 |
| Molecular Formula | C29H29FN3O6S+ |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | [(3R,5R)-14-(8-fluoro-6,11-dihydrobenzo[c][1]benzothiepin-10-yl)-9-hydroxy-5-methyl-12-oxo-1,2-diaza-8-azoniatricyclo[8.4.0.03,8]tetradeca-8,10,13-trien-11-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(c(-c3cc(F)cc4c3Cc3ccccc3SC4)cc1=O)N[C@@H]1C[C@H](C)CC[N+]1=C2O |
| InChI | InChI=1S/C29H28FN3O6S/c1-16-7-8-32-25(9-16)31-33-22(13-23(34)27(26(33)28(32)35)38-15-39-29(36)37-2)21-12-19(30)10-18-14-40-24-6-4-3-5-17(24)11-20(18)21/h3-6,10,12-13,16,25,31H,7-9,11,14-15H2,1-2H3/p+1/t16-,25+/m1/s1 |
| InChIKey | CFZYHGXDZMRKTH-CPJLOUKISA-O |
| XLogP | 4.60 |
| TPSA | 102.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|