C15H19N3 — CID 145333985
(E)-4-N-[1-(3,4-dihydro-2H-azepin-5-yl)ethenyl]-3-ethenylpent-2-ene-1,4-diimine (PubChem CID 145333985) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is (E)-4-N-[1-(3,4-dihydro-2H-azepin-5-yl)ethenyl]-3-ethenylpent-2-ene-1,4-diimine.
| Compound Name | (E)-4-N-[1-(3,4-dihydro-2H-azepin-5-yl)ethenyl]-3-ethenylpent-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 145333985 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (E)-4-N-[1-(3,4-dihydro-2H-azepin-5-yl)ethenyl]-3-ethenylpent-2-ene-1,4-diimine |
| SMILES | [H]/N=C/C=C(C=C)/C(C)=N\C(=C)C1=CC=NCCC1 |
| InChI | InChI=1S/C15H19N3/c1-4-14(7-9-16)12(2)18-13(3)15-6-5-10-17-11-8-15/h4,7-9,11,16H,1,3,5-6,10H2,2H3/b14-7+,16-9+,18-12+ |
| InChIKey | LKNNQWBMSRYYNQ-VSEAZFGMSA-N |
| XLogP | 3.51 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|