About 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane
2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane (PubChem CID 145334054) has the molecular formula C20H19ClN2
and a molecular weight of 322.84 g/mol. Its IUPAC name is 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane.
Molecular Properties
| Compound Name | 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane |
| PubChem CID | 145334054 |
| Molecular Formula | C20H19ClN2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane |
| SMILES | CC.Clc1nc(C2=CCCC=C2)c2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C18H13ClN2.C2H6/c19-18-20-16(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17(15)21-18;1-2/h2,4-11H,1,3H2;1-2H3 |
| InChIKey | BQSQNSRFOKVBLG-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane?
The IUPAC name of 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane (CID 145334054) is 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane.
What is the SMILES notation for 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane?
The canonical SMILES for 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane is CC.Clc1nc(C2=CCCC=C2)c2ccc3ccccc3c2n1.
What is the InChIKey of 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane?
The InChIKey is BQSQNSRFOKVBLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClN2.C2H6/c19-18-20-16(13-7-2-1-3-8-13)15-11-10-12-6-4-5-9-14(12)17(15)21-18;1-2/h2,4-11H,1,3H2;1-2H3.
What are the key properties of 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane?
2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane has a molecular weight of 322.84 g/mol, XLogP of 6.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-cyclohexa-1,5-dien-1-ylbenzo[h]quinazoline;ethane is sourced from PubChem (CID 145334054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).