About [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine
[3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine (PubChem CID 145334559) has the molecular formula C23H24BNO
and a molecular weight of 341.26 g/mol. Its IUPAC name is [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine.
Molecular Properties
| Compound Name | [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine |
| PubChem CID | 145334559 |
| Molecular Formula | C23H24BNO |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine |
| SMILES | CC1(C)CB(c2cccc(-c3cccc(C(N)c4ccccc4)c3)c2)O1 |
| InChI | InChI=1S/C23H24BNO/c1-23(2)16-24(26-23)21-13-7-11-19(15-21)18-10-6-12-20(14-18)22(25)17-8-4-3-5-9-17/h3-15,22H,16,25H2,1-2H3 |
| InChIKey | UCLMWVLIXBMLIT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine?
The IUPAC name of [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine (CID 145334559) is [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine.
What is the SMILES notation for [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine?
The canonical SMILES for [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine is CC1(C)CB(c2cccc(-c3cccc(C(N)c4ccccc4)c3)c2)O1.
What is the InChIKey of [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine?
The InChIKey is UCLMWVLIXBMLIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24BNO/c1-23(2)16-24(26-23)21-13-7-11-19(15-21)18-10-6-12-20(14-18)22(25)17-8-4-3-5-9-17/h3-15,22H,16,25H2,1-2H3.
What are the key properties of [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine?
[3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine has a molecular weight of 341.26 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-(4,4-dimethyloxaboretan-2-yl)phenyl]phenyl]-phenylmethanamine is sourced from PubChem (CID 145334559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).