C22H27Cl2N5O4 — CID 145335851
1-[(3,4-dichlorophenyl)methyl]-8-[[(3S)-3-[hydroxy(methoxy)methyl]cyclohexyl]amino]-3,7-dimethylpurine-2,6-dione (PubChem CID 145335851) has the molecular formula C22H27Cl2N5O4 and a molecular weight of 496.40 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-8-[[(3S)-3-[hydroxy(methoxy)methyl]cyclohexyl]amino]-3,7-dimethylpurine-2,6-dione.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-8-[[(3S)-3-[hydroxy(methoxy)methyl]cyclohexyl]amino]-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 145335851 |
| Molecular Formula | C22H27Cl2N5O4 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-8-[[(3S)-3-[hydroxy(methoxy)methyl]cyclohexyl]amino]-3,7-dimethylpurine-2,6-dione |
| SMILES | COC(O)[C@H]1CCCC(Nc2nc3c(c(=O)n(Cc4ccc(Cl)c(Cl)c4)c(=O)n3C)n2C)C1 |
| InChI | InChI=1S/C22H27Cl2N5O4/c1-27-17-18(26-21(27)25-14-6-4-5-13(10-14)20(31)33-3)28(2)22(32)29(19(17)30)11-12-7-8-15(23)16(24)9-12/h7-9,13-14,20,31H,4-6,10-11H2,1-3H3,(H,25,26)/t13-,14?,20?/m0/s1 |
| InChIKey | NFJPWBNZEAOZHV-LTQQYIGLSA-N |
| XLogP | 2.72 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|