About 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione
2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione (PubChem CID 145336592) has the molecular formula C26H22BrClO6
and a molecular weight of 545.81 g/mol. Its IUPAC name is 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione |
| PubChem CID | 145336592 |
| Molecular Formula | C26H22BrClO6 |
| Molecular Weight | 545.81 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione |
| SMILES | CC(C)OC1=C(Br)C(=O)c2ccccc2C1=O.CC(C)OC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11BrO3.C13H11ClO3/c2*1-7(2)17-13-10(14)11(15)8-5-3-4-6-9(8)12(13)16/h2*3-7H,1-2H3 |
| InChIKey | BGHZPINCHMPDOR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione?
The IUPAC name of 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione (CID 145336592) is 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione.
What is the SMILES notation for 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione?
The canonical SMILES for 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione is CC(C)OC1=C(Br)C(=O)c2ccccc2C1=O.CC(C)OC1=C(Cl)C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione?
The InChIKey is BGHZPINCHMPDOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO3.C13H11ClO3/c2*1-7(2)17-13-10(14)11(15)8-5-3-4-6-9(8)12(13)16/h2*3-7H,1-2H3.
What are the key properties of 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione?
2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione has a molecular weight of 545.81 g/mol, XLogP of 6.04, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-propan-2-yloxynaphthalene-1,4-dione;2-chloro-3-propan-2-yloxynaphthalene-1,4-dione is sourced from PubChem (CID 145336592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).