C29H28F3NO3S — CID 145337403
(3R)-2-(4-cyclopropylphenyl)-3-methyl-1-[4-[(E)-2-methylperoxyethenyl]phenyl]-6-(trifluoromethylsulfanyloxy)-3,4-dihydro-1H-isoquinoline (PubChem CID 145337403) has the molecular formula C29H28F3NO3S and a molecular weight of 527.61 g/mol. Its IUPAC name is (3R)-2-(4-cyclopropylphenyl)-3-methyl-1-[4-[(E)-2-methylperoxyethenyl]phenyl]-6-(trifluoromethylsulfanyloxy)-3,4-dihydro-1H-isoquinoline.
| Compound Name | (3R)-2-(4-cyclopropylphenyl)-3-methyl-1-[4-[(E)-2-methylperoxyethenyl]phenyl]-6-(trifluoromethylsulfanyloxy)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 145337403 |
| Molecular Formula | C29H28F3NO3S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | (3R)-2-(4-cyclopropylphenyl)-3-methyl-1-[4-[(E)-2-methylperoxyethenyl]phenyl]-6-(trifluoromethylsulfanyloxy)-3,4-dihydro-1H-isoquinoline |
| SMILES | COO/C=C/c1ccc(C2c3ccc(OSC(F)(F)F)cc3C[C@@H](C)N2c2ccc(C3CC3)cc2)cc1 |
| InChI | InChI=1S/C29H28F3NO3S/c1-19-17-24-18-26(36-37-29(30,31)32)13-14-27(24)28(23-5-3-20(4-6-23)15-16-35-34-2)33(19)25-11-9-22(10-12-25)21-7-8-21/h3-6,9-16,18-19,21,28H,7-8,17H2,1-2H3/b16-15+/t19-,28?/m1/s1 |
| InChIKey | SBZPMVWEEIKNRA-ZVMIJPJTSA-N |
| XLogP | 8.20 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|