C12H21NO2 — CID 145337566
2-[(1R,3R)-3-ethenyl-6-bicyclo[3.2.0]heptanyl]acetic acid;methanamine (PubChem CID 145337566) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-[(1R,3R)-3-ethenyl-6-bicyclo[3.2.0]heptanyl]acetic acid;methanamine.
| Compound Name | 2-[(1R,3R)-3-ethenyl-6-bicyclo[3.2.0]heptanyl]acetic acid;methanamine |
|---|---|
| PubChem CID | 145337566 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-[(1R,3R)-3-ethenyl-6-bicyclo[3.2.0]heptanyl]acetic acid;methanamine |
| SMILES | C=C[C@H]1CC2C(CC(=O)O)C[C@H]2C1.CN |
| InChI | InChI=1S/C11H16O2.CH5N/c1-2-7-3-8-5-9(6-11(12)13)10(8)4-7;1-2/h2,7-10H,1,3-6H2,(H,12,13);2H2,1H3/t7-,8-,9?,10?;/m1./s1 |
| InChIKey | PWSLGPMOLCJSBT-HYQVXADHSA-N |
| XLogP | 1.88 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|