C13H19F2N — CID 145337599
[(1R,5R,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine (PubChem CID 145337599) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is [(1R,5R,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine.
| Compound Name | [(1R,5R,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine |
|---|---|
| PubChem CID | 145337599 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [(1R,5R,6S)-3-[(3,3-difluorocyclobutyl)methyl]-6-bicyclo[3.2.0]hept-3-enyl]methanamine |
| SMILES | NC[C@H]1C[C@@H]2CC(CC3CC(F)(F)C3)=C[C@H]12 |
| InChI | InChI=1S/C13H19F2N/c14-13(15)5-9(6-13)1-8-2-10-4-11(7-16)12(10)3-8/h3,9-12H,1-2,4-7,16H2/t10-,11+,12-/m0/s1 |
| InChIKey | RZFWOPYICQJNQL-TUAOUCFPSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|