C32H32F4N4O — CID 145337943
(5R)-5-[(1S)-3,3-difluorocyclohexyl]-5H-imidazo[5,1-a]isoindole;trans-(1R,2S)-4,4-difluoro-2-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]cyclohexan-1-ol (PubChem CID 145337943) has the molecular formula C32H32F4N4O and a molecular weight of 564.63 g/mol. Its IUPAC name is (5R)-5-[(1S)-3,3-difluorocyclohexyl]-5H-imidazo[5,1-a]isoindole;trans-(1R,2S)-4,4-difluoro-2-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]cyclohexan-1-ol.
| Compound Name | (5R)-5-[(1S)-3,3-difluorocyclohexyl]-5H-imidazo[5,1-a]isoindole;trans-(1R,2S)-4,4-difluoro-2-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 145337943 |
| Molecular Formula | C32H32F4N4O |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (5R)-5-[(1S)-3,3-difluorocyclohexyl]-5H-imidazo[5,1-a]isoindole;trans-(1R,2S)-4,4-difluoro-2-[(5R)-5H-imidazo[5,1-a]isoindol-5-yl]cyclohexan-1-ol |
| SMILES | FC1(F)CCC[C@H]([C@@H]2c3ccccc3-c3cncn32)C1.O[C@@H]1CCC(F)(F)C[C@H]1[C@@H]1c2ccccc2-c2cncn21 |
| InChI | InChI=1S/C16H16F2N2O.C16H16F2N2/c17-16(18)6-5-14(21)12(7-16)15-11-4-2-1-3-10(11)13-8-19-9-20(13)15;17-16(18)7-3-4-11(8-16)15-13-6-2-1-5-12(13)14-9-19-10-20(14)15/h1-4,8-9,12,14-15,21H,5-7H2;1-2,5-6,9-11,15H,3-4,7-8H2/t12-,14-,15+;11-,15+/m10/s1 |
| InChIKey | GWCYYCISPSWUOZ-MOCOTIHWSA-N |
| XLogP | 7.53 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |