About 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane
1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane (PubChem CID 145338154) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane |
| PubChem CID | 145338154 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane |
| SMILES | CC.Cc1nc(C(C)C)n(C)n1 |
| InChI | InChI=1S/C7H13N3.C2H6/c1-5(2)7-8-6(3)9-10(7)4;1-2/h5H,1-4H3;1-2H3 |
| InChIKey | RDJDHJQDNXBMIP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane?
The IUPAC name of 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane (CID 145338154) is 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane.
What is the SMILES notation for 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane?
The canonical SMILES for 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane is CC.Cc1nc(C(C)C)n(C)n1.
What is the InChIKey of 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane?
The InChIKey is RDJDHJQDNXBMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3.C2H6/c1-5(2)7-8-6(3)9-10(7)4;1-2/h5H,1-4H3;1-2H3.
What are the key properties of 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane?
1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane has a molecular weight of 169.27 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-propan-2-yl-1,2,4-triazole;ethane is sourced from PubChem (CID 145338154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).