C15H24NO2P — CID 145338512
2-[4-[(5-methyl-2-phosphanyloxyphenyl)methyl]piperidin-1-yl]ethanol (PubChem CID 145338512) has the molecular formula C15H24NO2P and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-[4-[(5-methyl-2-phosphanyloxyphenyl)methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[(5-methyl-2-phosphanyloxyphenyl)methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 145338512 |
| Molecular Formula | C15H24NO2P |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-[4-[(5-methyl-2-phosphanyloxyphenyl)methyl]piperidin-1-yl]ethanol |
| SMILES | Cc1ccc(OP)c(CC2CCN(CCO)CC2)c1 |
| InChI | InChI=1S/C15H24NO2P/c1-12-2-3-15(18-19)14(10-12)11-13-4-6-16(7-5-13)8-9-17/h2-3,10,13,17H,4-9,11,19H2,1H3 |
| InChIKey | VEGXTOHSNRCUCY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|