About 2,3-bis(ethenoxy)butane
2,3-bis(ethenoxy)butane (PubChem CID 14533869) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2,3-bis(ethenoxy)butane.
Molecular Properties
| Compound Name | 2,3-bis(ethenoxy)butane |
| PubChem CID | 14533869 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2,3-bis(ethenoxy)butane |
| SMILES | C=COC(C)C(C)OC=C |
| InChI | InChI=1S/C8H14O2/c1-5-9-7(3)8(4)10-6-2/h5-8H,1-2H2,3-4H3 |
| InChIKey | WJSSGRNOLJPGNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(ethenoxy)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenoxy)butane?
The IUPAC name of 2,3-bis(ethenoxy)butane (CID 14533869) is 2,3-bis(ethenoxy)butane.
What is the SMILES notation for 2,3-bis(ethenoxy)butane?
The canonical SMILES for 2,3-bis(ethenoxy)butane is C=COC(C)C(C)OC=C.
What is the InChIKey of 2,3-bis(ethenoxy)butane?
The InChIKey is WJSSGRNOLJPGNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-5-9-7(3)8(4)10-6-2/h5-8H,1-2H2,3-4H3.
What are the key properties of 2,3-bis(ethenoxy)butane?
2,3-bis(ethenoxy)butane has a molecular weight of 142.20 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenoxy)butane is sourced from PubChem (CID 14533869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).