C16H23NO2 — CID 145338817
ethane;5-methyl-2-(oxan-4-yl)-3H-isoindol-1-one (PubChem CID 145338817) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is ethane;5-methyl-2-(oxan-4-yl)-3H-isoindol-1-one.
| Compound Name | ethane;5-methyl-2-(oxan-4-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 145338817 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethane;5-methyl-2-(oxan-4-yl)-3H-isoindol-1-one |
| SMILES | CC.Cc1ccc2c(c1)CN(C1CCOCC1)C2=O |
| InChI | InChI=1S/C14H17NO2.C2H6/c1-10-2-3-13-11(8-10)9-15(14(13)16)12-4-6-17-7-5-12;1-2/h2-3,8,12H,4-7,9H2,1H3;1-2H3 |
| InChIKey | XENSVDFBXNDMPB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |