C10H21F3N2O — CID 145338873
ethane;1-(4-ethylpiperazin-1-yl)-2,2,2-trifluoroethanol (PubChem CID 145338873) has the molecular formula C10H21F3N2O and a molecular weight of 242.28 g/mol. Its IUPAC name is ethane;1-(4-ethylpiperazin-1-yl)-2,2,2-trifluoroethanol.
| Compound Name | ethane;1-(4-ethylpiperazin-1-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 145338873 |
| Molecular Formula | C10H21F3N2O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | ethane;1-(4-ethylpiperazin-1-yl)-2,2,2-trifluoroethanol |
| SMILES | CC.CCN1CCN(C(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H15F3N2O.C2H6/c1-2-12-3-5-13(6-4-12)7(14)8(9,10)11;1-2/h7,14H,2-6H2,1H3;1-2H3 |
| InChIKey | OESASKSYJFYSRW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |