C34H46N6O2 — CID 145338929
N-(3-amino-5-tert-butylphenyl)acetamide;N,N-dimethyl-2-[6-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oxy]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-2-amine (PubChem CID 145338929) has the molecular formula C34H46N6O2 and a molecular weight of 570.78 g/mol. Its IUPAC name is N-(3-amino-5-tert-butylphenyl)acetamide;N,N-dimethyl-2-[6-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oxy]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-2-amine.
| Compound Name | N-(3-amino-5-tert-butylphenyl)acetamide;N,N-dimethyl-2-[6-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oxy]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-2-amine |
|---|---|
| PubChem CID | 145338929 |
| Molecular Formula | C34H46N6O2 |
| Molecular Weight | 570.78 g/mol |
| Exact Mass | 570.37 |
| IUPAC Name | N-(3-amino-5-tert-butylphenyl)acetamide;N,N-dimethyl-2-[6-[(4-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)oxy]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]propan-2-amine |
| SMILES | CC(=O)Nc1cc(N)cc(C(C)(C)C)c1.CC1CCC(Oc2ccc3nnc(C(C)(C)N(C)C)n3c2)c2ccccc21 |
| InChI | InChI=1S/C22H28N4O.C12H18N2O/c1-15-10-12-19(18-9-7-6-8-17(15)18)27-16-11-13-20-23-24-21(26(20)14-16)22(2,3)25(4)5;1-8(15)14-11-6-9(12(2,3)4)5-10(13)7-11/h6-9,11,13-15,19H,10,12H2,1-5H3;5-7H,13H2,1-4H3,(H,14,15) |
| InChIKey | HXQRFJUATQHRFH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.78 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|