C19H30O2 — CID 145339045
7-(methoxymethyl)-3,10,11-trimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one (PubChem CID 145339045) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 7-(methoxymethyl)-3,10,11-trimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one.
| Compound Name | 7-(methoxymethyl)-3,10,11-trimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one |
|---|---|
| PubChem CID | 145339045 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 7-(methoxymethyl)-3,10,11-trimethyltricyclo[7.4.1.01,5]tetradec-7-en-14-one |
| SMILES | COCC1=CC2C(=O)C3(CCC(C)C2C)CC(C)CC3C1 |
| InChI | InChI=1S/C19H30O2/c1-12-7-16-8-15(11-21-4)9-17-14(3)13(2)5-6-19(16,10-12)18(17)20/h9,12-14,16-17H,5-8,10-11H2,1-4H3 |
| InChIKey | VGHLSDWZVIFGQW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|