About methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate
methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate (PubChem CID 145339129) has the molecular formula C17H24FNO
and a molecular weight of 277.38 g/mol. Its IUPAC name is methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate.
Molecular Properties
| Compound Name | methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate |
| PubChem CID | 145339129 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate |
| SMILES | [H]/N=C(/CC1(c2cc(C)c(F)c(C)c2)CCCCC1)OC |
| InChI | InChI=1S/C17H24FNO/c1-12-9-14(10-13(2)16(12)18)17(11-15(19)20-3)7-5-4-6-8-17/h9-10,19H,4-8,11H2,1-3H3/b19-15- |
| InChIKey | HHNKRSLHPOAJFX-CYVLTUHYSA-N |
| XLogP | 4.66 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate?
The IUPAC name of methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate (CID 145339129) is methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate.
What is the SMILES notation for methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate?
The canonical SMILES for methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate is [H]/N=C(/CC1(c2cc(C)c(F)c(C)c2)CCCCC1)OC.
What is the InChIKey of methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate?
The InChIKey is HHNKRSLHPOAJFX-CYVLTUHYSA-N. The full InChI is InChI=1S/C17H24FNO/c1-12-9-14(10-13(2)16(12)18)17(11-15(19)20-3)7-5-4-6-8-17/h9-10,19H,4-8,11H2,1-3H3/b19-15-.
What are the key properties of methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate?
methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate has a molecular weight of 277.38 g/mol, XLogP of 4.66, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(4-fluoro-3,5-dimethylphenyl)cyclohexyl]ethanimidate is sourced from PubChem (CID 145339129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).