About ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium
ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium (PubChem CID 145339265) has the molecular formula C14H22N+
and a molecular weight of 204.34 g/mol. Its IUPAC name is ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium.
Molecular Properties
| Compound Name | ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium |
| PubChem CID | 145339265 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium |
| SMILES | CC.CC[N+]1=C(C)c2ccccc2CC1 |
| InChI | InChI=1S/C12H16N.C2H6/c1-3-13-9-8-11-6-4-5-7-12(11)10(13)2;1-2/h4-7H,3,8-9H2,1-2H3;1-2H3/q+1; |
| InChIKey | XBQTVDUITLQRRP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium?
The IUPAC name of ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium (CID 145339265) is ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium.
What is the SMILES notation for ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium?
The canonical SMILES for ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium is CC.CC[N+]1=C(C)c2ccccc2CC1.
What is the InChIKey of ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium?
The InChIKey is XBQTVDUITLQRRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N.C2H6/c1-3-13-9-8-11-6-4-5-7-12(11)10(13)2;1-2/h4-7H,3,8-9H2,1-2H3;1-2H3/q+1;.
What are the key properties of ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium?
ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium has a molecular weight of 204.34 g/mol, XLogP of 3.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-1-methyl-3,4-dihydroisoquinolin-2-ium is sourced from PubChem (CID 145339265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).