About 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione
2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione (PubChem CID 145340196) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione |
| PubChem CID | 145340196 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione |
| SMILES | CC(C)(C)C.CC(C)C1CC(=O)OC1=O |
| InChI | InChI=1S/C7H10O3.C5H12/c1-4(2)5-3-6(8)10-7(5)9;1-5(2,3)4/h4-5H,3H2,1-2H3;1-4H3 |
| InChIKey | QANOZWNMAUBHLX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione?
The IUPAC name of 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione (CID 145340196) is 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione.
What is the SMILES notation for 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione?
The canonical SMILES for 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione is CC(C)(C)C.CC(C)C1CC(=O)OC1=O.
What is the InChIKey of 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione?
The InChIKey is QANOZWNMAUBHLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.C5H12/c1-4(2)5-3-6(8)10-7(5)9;1-5(2,3)4/h4-5H,3H2,1-2H3;1-4H3.
What are the key properties of 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione?
2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione has a molecular weight of 214.30 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;3-propan-2-yloxolane-2,5-dione is sourced from PubChem (CID 145340196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).