About tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate
tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate (PubChem CID 145340440) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate |
| PubChem CID | 145340440 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate |
| SMILES | C=CC1=C(C)CC(NC(=O)OC(C)(C)C)CO1 |
| InChI | InChI=1S/C13H21NO3/c1-6-11-9(2)7-10(8-16-11)14-12(15)17-13(3,4)5/h6,10H,1,7-8H2,2-5H3,(H,14,15) |
| InChIKey | YGRHBMRXLACLJE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate?
The IUPAC name of tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate (CID 145340440) is tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate.
What is the SMILES notation for tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate?
The canonical SMILES for tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate is C=CC1=C(C)CC(NC(=O)OC(C)(C)C)CO1.
What is the InChIKey of tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate?
The InChIKey is YGRHBMRXLACLJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO3/c1-6-11-9(2)7-10(8-16-11)14-12(15)17-13(3,4)5/h6,10H,1,7-8H2,2-5H3,(H,14,15).
What are the key properties of tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate?
tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate has a molecular weight of 239.31 g/mol, XLogP of 2.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(6-ethenyl-5-methyl-3,4-dihydro-2H-pyran-3-yl)carbamate is sourced from PubChem (CID 145340440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).