C55H48N4 — CID 145340789
[4-[2-[3-(9,9-dimethylfluoren-2-yl)phenyl]carbazol-9-yl]phenyl]-phenylmethanimine;(methylideneamino)methanamine;toluene (PubChem CID 145340789) has the molecular formula C55H48N4 and a molecular weight of 765.02 g/mol. Its IUPAC name is [4-[2-[3-(9,9-dimethylfluoren-2-yl)phenyl]carbazol-9-yl]phenyl]-phenylmethanimine;(methylideneamino)methanamine;toluene.
| Compound Name | [4-[2-[3-(9,9-dimethylfluoren-2-yl)phenyl]carbazol-9-yl]phenyl]-phenylmethanimine;(methylideneamino)methanamine;toluene |
|---|---|
| PubChem CID | 145340789 |
| Molecular Formula | C55H48N4 |
| Molecular Weight | 765.02 g/mol |
| Exact Mass | 764.39 |
| IUPAC Name | [4-[2-[3-(9,9-dimethylfluoren-2-yl)phenyl]carbazol-9-yl]phenyl]-phenylmethanimine;(methylideneamino)methanamine;toluene |
| SMILES | C=NCN.Cc1ccccc1.[H]/N=C(\c1ccccc1)c1ccc(-n2c3ccccc3c3ccc(-c4cccc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)c4)cc32)cc1 |
| InChI | InChI=1S/C46H34N2.C7H8.C2H6N2/c1-46(2)41-17-8-6-15-37(41)38-25-21-34(28-42(38)46)32-13-10-14-33(27-32)35-22-26-40-39-16-7-9-18-43(39)48(44(40)29-35)36-23-19-31(20-24-36)45(47)30-11-4-3-5-12-30;1-7-5-3-2-4-6-7;1-4-2-3/h3-29,47H,1-2H3;2-6H,1H3;1-3H2/b47-45+;; |
| InChIKey | QTCQKOCTDBJIIX-BSSSLTCASA-N |
| XLogP | 13.44 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.02 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|