C40H26F8O — CID 145340814
2-[7-(1,1,2,2,3,3,4,4-octafluoropentoxy)naphthalen-2-yl]-9,9-diphenylfluorene (PubChem CID 145340814) has the molecular formula C40H26F8O and a molecular weight of 674.63 g/mol. Its IUPAC name is 2-[7-(1,1,2,2,3,3,4,4-octafluoropentoxy)naphthalen-2-yl]-9,9-diphenylfluorene.
| Compound Name | 2-[7-(1,1,2,2,3,3,4,4-octafluoropentoxy)naphthalen-2-yl]-9,9-diphenylfluorene |
|---|---|
| PubChem CID | 145340814 |
| Molecular Formula | C40H26F8O |
| Molecular Weight | 674.63 g/mol |
| Exact Mass | 674.19 |
| IUPAC Name | 2-[7-(1,1,2,2,3,3,4,4-octafluoropentoxy)naphthalen-2-yl]-9,9-diphenylfluorene |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)Oc1ccc2ccc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccccc3-4)cc2c1 |
| InChI | InChI=1S/C40H26F8O/c1-36(41,42)38(43,44)39(45,46)40(47,48)49-31-20-18-25-16-17-26(22-28(25)23-31)27-19-21-33-32-14-8-9-15-34(32)37(35(33)24-27,29-10-4-2-5-11-29)30-12-6-3-7-13-30/h2-24H,1H3 |
| InChIKey | PCPYEPWRKWLBQP-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.63 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|