About 4-cyclohexa-1,5-dien-1-yloxypiperidine
4-cyclohexa-1,5-dien-1-yloxypiperidine (PubChem CID 145341734) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yloxypiperidine.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yloxypiperidine |
| PubChem CID | 145341734 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yloxypiperidine |
| SMILES | C1=CC(OC2CCNCC2)=CCC1 |
| InChI | InChI=1S/C11H17NO/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h2,4-5,11-12H,1,3,6-9H2 |
| InChIKey | ZEDRFZOSBAVPKW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,5-dien-1-yloxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yloxypiperidine?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yloxypiperidine (CID 145341734) is 4-cyclohexa-1,5-dien-1-yloxypiperidine.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yloxypiperidine?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yloxypiperidine is C1=CC(OC2CCNCC2)=CCC1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yloxypiperidine?
The InChIKey is ZEDRFZOSBAVPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h2,4-5,11-12H,1,3,6-9H2.
What are the key properties of 4-cyclohexa-1,5-dien-1-yloxypiperidine?
4-cyclohexa-1,5-dien-1-yloxypiperidine has a molecular weight of 179.26 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yloxypiperidine is sourced from PubChem (CID 145341734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).