About ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine
ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine (PubChem CID 145341988) has the molecular formula C21H45N3
and a molecular weight of 339.61 g/mol. Its IUPAC name is ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine.
Molecular Properties
| Compound Name | ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine |
| PubChem CID | 145341988 |
| Molecular Formula | C21H45N3 |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 339.36 |
| IUPAC Name | ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine |
| SMILES | CC.CC/C=C\C(CN(C)CC(C)C)=N/C.CCN1CCCCC1 |
| InChI | InChI=1S/C12H24N2.C7H15N.C2H6/c1-6-7-8-12(13-4)10-14(5)9-11(2)3;1-2-8-6-4-3-5-7-8;1-2/h7-8,11H,6,9-10H2,1-5H3;2-7H2,1H3;1-2H3/b8-7-,13-12+;; |
| InChIKey | OUBBUJCXYKMEHS-GZSWNXSFSA-N |
| XLogP | 5.13 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine?
The IUPAC name of ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine (CID 145341988) is ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine.
What is the SMILES notation for ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine?
The canonical SMILES for ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine is CC.CC/C=C\C(CN(C)CC(C)C)=N/C.CCN1CCCCC1.
What is the InChIKey of ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine?
The InChIKey is OUBBUJCXYKMEHS-GZSWNXSFSA-N. The full InChI is InChI=1S/C12H24N2.C7H15N.C2H6/c1-6-7-8-12(13-4)10-14(5)9-11(2)3;1-2-8-6-4-3-5-7-8;1-2/h7-8,11H,6,9-10H2,1-5H3;2-7H2,1H3;1-2H3/b8-7-,13-12+;;.
What are the key properties of ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine?
ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine has a molecular weight of 339.61 g/mol, XLogP of 5.13, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethylpiperidine;(Z)-N-methyl-2-methylimino-N-(2-methylpropyl)hex-3-en-1-amine is sourced from PubChem (CID 145341988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).