About ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine
ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine (PubChem CID 145342944) has the molecular formula C11H26N2S
and a molecular weight of 218.41 g/mol. Its IUPAC name is ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine.
Molecular Properties
| Compound Name | ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine |
| PubChem CID | 145342944 |
| Molecular Formula | C11H26N2S |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine |
| SMILES | C=CC(CC(=C)NC)SC.CC.CN |
| InChI | InChI=1S/C8H15NS.C2H6.CH5N/c1-5-8(10-4)6-7(2)9-3;2*1-2/h5,8-9H,1-2,6H2,3-4H3;1-2H3;2H2,1H3 |
| InChIKey | YPHKQMWORDXEPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine?
The IUPAC name of ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine (CID 145342944) is ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine.
What is the SMILES notation for ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine?
The canonical SMILES for ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine is C=CC(CC(=C)NC)SC.CC.CN.
What is the InChIKey of ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine?
The InChIKey is YPHKQMWORDXEPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS.C2H6.CH5N/c1-5-8(10-4)6-7(2)9-3;2*1-2/h5,8-9H,1-2,6H2,3-4H3;1-2H3;2H2,1H3.
What are the key properties of ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine?
ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine has a molecular weight of 218.41 g/mol, XLogP of 2.63, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;N-methyl-4-methylsulfanylhexa-1,5-dien-2-amine is sourced from PubChem (CID 145342944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).