About 2,3-dimethylfuran;propane
2,3-dimethylfuran;propane (PubChem CID 145343494) has the molecular formula C12H24O
and a molecular weight of 184.32 g/mol. Its IUPAC name is 2,3-dimethylfuran;propane.
Molecular Properties
| Compound Name | 2,3-dimethylfuran;propane |
| PubChem CID | 145343494 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 2,3-dimethylfuran;propane |
| SMILES | CCC.CCC.Cc1ccoc1C |
| InChI | InChI=1S/C6H8O.2C3H8/c1-5-3-4-7-6(5)2;2*1-3-2/h3-4H,1-2H3;2*3H2,1-2H3 |
| InChIKey | HVYGBEVBESIOQA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethylfuran;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylfuran;propane?
The IUPAC name of 2,3-dimethylfuran;propane (CID 145343494) is 2,3-dimethylfuran;propane.
What is the SMILES notation for 2,3-dimethylfuran;propane?
The canonical SMILES for 2,3-dimethylfuran;propane is CCC.CCC.Cc1ccoc1C.
What is the InChIKey of 2,3-dimethylfuran;propane?
The InChIKey is HVYGBEVBESIOQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O.2C3H8/c1-5-3-4-7-6(5)2;2*1-3-2/h3-4H,1-2H3;2*3H2,1-2H3.
What are the key properties of 2,3-dimethylfuran;propane?
2,3-dimethylfuran;propane has a molecular weight of 184.32 g/mol, XLogP of 4.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylfuran;propane is sourced from PubChem (CID 145343494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).