About [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone
[4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone (PubChem CID 145344163) has the molecular formula C22H23NO
and a molecular weight of 317.43 g/mol. Its IUPAC name is [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone.
Molecular Properties
| Compound Name | [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone |
| PubChem CID | 145344163 |
| Molecular Formula | C22H23NO |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone |
| SMILES | C=C/C=C(\C=C)N(CC)c1ccc(C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H23NO/c1-5-8-20(6-2)23(7-3)21-15-13-19(14-16-21)22(24)18-11-9-17(4)10-12-18/h5-6,8-16H,1-2,7H2,3-4H3/b20-8+ |
| InChIKey | WMERNLHSNBONLB-DNTJNYDQSA-N |
| XLogP | 5.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone?
The IUPAC name of [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone (CID 145344163) is [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone.
What is the SMILES notation for [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone?
The canonical SMILES for [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone is C=C/C=C(\C=C)N(CC)c1ccc(C(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone?
The InChIKey is WMERNLHSNBONLB-DNTJNYDQSA-N. The full InChI is InChI=1S/C22H23NO/c1-5-8-20(6-2)23(7-3)21-15-13-19(14-16-21)22(24)18-11-9-17(4)10-12-18/h5-6,8-16H,1-2,7H2,3-4H3/b20-8+.
What are the key properties of [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone?
[4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone has a molecular weight of 317.43 g/mol, XLogP of 5.31, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[ethyl-[(3E)-hexa-1,3,5-trien-3-yl]amino]phenyl]-(4-methylphenyl)methanone is sourced from PubChem (CID 145344163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).