C40H28N6O — CID 145345116
6-(9,9-dimethylacridin-10-yl)-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 145345116) has the molecular formula C40H28N6O and a molecular weight of 608.71 g/mol. Its IUPAC name is 6-(9,9-dimethylacridin-10-yl)-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 6-(9,9-dimethylacridin-10-yl)-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 145345116 |
| Molecular Formula | C40H28N6O |
| Molecular Weight | 608.71 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 6-(9,9-dimethylacridin-10-yl)-10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-4,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | CC1(C)c2ccccc2N(c2cncc3c2oc2c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cncc23)c2ccccc21 |
| InChI | InChI=1S/C40H28N6O/c1-40(2)30-17-9-11-19-32(30)46(33-20-12-10-18-31(33)40)34-24-42-22-28-27-21-41-23-29(35(27)47-36(28)34)39-44-37(25-13-5-3-6-14-25)43-38(45-39)26-15-7-4-8-16-26/h3-24H,1-2H3 |
| InChIKey | WGOCBHUOTTXVEC-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 80.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.71 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |